[Cl−]needed for PbCl2=Ksp(PbCl2)[Pb2+]open bracket Cl raised to the negative power close bracket sub needed for PbCl sub 2 end-sub equals the square root of the fraction with numerator cap K sub s p end-sub open paren PbCl sub 2 close paren and denominator open bracket Pb raised to the 2 plus power close bracket end-fraction end-root Step 3: Determine the Order of Precipitation
). The 2021 version typically focuses on a model involving and copper(II) ions reacting with sodium carbonate . Core Concepts of the POGIL Activity
value: The compound is more soluble and requires a higher concentration of the precipitating ion to fall out of solution. 2. Reaction Quotient ( ) vs. Equilibrium Constant ( Kspcap K sub s p end-sub The ion product (
of its original concentration before the second ion begins to precipitate.
expression of the ion to solve for the remaining concentration of the first ion. Common Misconceptions Addressed in POGIL
What are the listed in your POGIL prompt? What are the given Kspcap K sub s p end-sub values for those compounds?
Would you like me to:
A common "Critical Thinking Question" in POGILs asks: What is the concentration of the first ion remaining when the second ion begins to precipitate? To solve this: Calculate the concentration of the added reagent (e.g., Ag+cap A g raised to the positive power ) needed to start the precipitation. Plug that value back into the Kspcap K sub s p end-sub expression of the first substance. Solve for the remaining concentration of the first ion. Step 4: Is the Separation Effective?